C14H17IN2O3 — CID 167451550
tert-butyl 5-(4-iodophenyl)-2-oxoimidazolidine-1-carboxylate (PubChem CID 167451550) has the molecular formula C14H17IN2O3 and a molecular weight of 388.21 g/mol. Its IUPAC name is tert-butyl 5-(4-iodophenyl)-2-oxoimidazolidine-1-carboxylate.
| Compound Name | tert-butyl 5-(4-iodophenyl)-2-oxoimidazolidine-1-carboxylate |
|---|---|
| PubChem CID | 167451550 |
| Molecular Formula | C14H17IN2O3 |
| Molecular Weight | 388.21 g/mol |
| Exact Mass | 388.03 |
| IUPAC Name | tert-butyl 5-(4-iodophenyl)-2-oxoimidazolidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1C(=O)NCC1c1ccc(I)cc1 |
| InChI | InChI=1S/C14H17IN2O3/c1-14(2,3)20-13(19)17-11(8-16-12(17)18)9-4-6-10(15)7-5-9/h4-7,11H,8H2,1-3H3,(H,16,18) |
| InChIKey | SJDYGELEQFJLEH-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.21 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|