C23H23Cl2F3N2O3 — CID 71009037
(3aR,7aS)-2-[2-(2,4-dichlorophenyl)-2-hydroxyethyl]-5-[4-(2,2,2-trifluoroethoxy)phenyl]-1,3,3a,6,7,7a-hexahydropyrrolo[3,4-c]pyridin-4-one (PubChem CID 71009037) has the molecular formula C23H23Cl2F3N2O3 and a molecular weight of 503.35 g/mol. Its IUPAC name is (3aR,7aS)-2-[2-(2,4-dichlorophenyl)-2-hydroxyethyl]-5-[4-(2,2,2-trifluoroethoxy)phenyl]-1,3,3a,6,7,7a-hexahydropyrrolo[3,4-c]pyridin-4-one.
| Compound Name | (3aR,7aS)-2-[2-(2,4-dichlorophenyl)-2-hydroxyethyl]-5-[4-(2,2,2-trifluoroethoxy)phenyl]-1,3,3a,6,7,7a-hexahydropyrrolo[3,4-c]pyridin-4-one |
|---|---|
| PubChem CID | 71009037 |
| Molecular Formula | C23H23Cl2F3N2O3 |
| Molecular Weight | 503.35 g/mol |
| Exact Mass | 502.10 |
| IUPAC Name | (3aR,7aS)-2-[2-(2,4-dichlorophenyl)-2-hydroxyethyl]-5-[4-(2,2,2-trifluoroethoxy)phenyl]-1,3,3a,6,7,7a-hexahydropyrrolo[3,4-c]pyridin-4-one |
| SMILES | O=C1[C@H]2CN(CC(O)c3ccc(Cl)cc3Cl)C[C@H]2CCN1c1ccc(OCC(F)(F)F)cc1 |
| InChI | InChI=1S/C23H23Cl2F3N2O3/c24-15-1-6-18(20(25)9-15)21(31)12-29-10-14-7-8-30(22(32)19(14)11-29)16-2-4-17(5-3-16)33-13-23(26,27)28/h1-6,9,14,19,21,31H,7-8,10-13H2/t14-,19+,21?/m1/s1 |
| InChIKey | TZYWCWPNWKEQCG-ANEWXZNUSA-N |
| XLogP | 4.95 |
| TPSA | 53.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.35 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |