C4H7O6S2- — CID 7102151
(3S,4R)-4-hydroxy-1,1-dioxothiolane-3-sulfonate (PubChem CID 7102151) has the molecular formula C4H7O6S2- and a molecular weight of 215.23 g/mol. Its IUPAC name is (3S,4R)-4-hydroxy-1,1-dioxothiolane-3-sulfonate.
| Compound Name | (3S,4R)-4-hydroxy-1,1-dioxothiolane-3-sulfonate |
|---|---|
| PubChem CID | 7102151 |
| Molecular Formula | C4H7O6S2- |
| Molecular Weight | 215.23 g/mol |
| Exact Mass | 214.97 |
| IUPAC Name | (3S,4R)-4-hydroxy-1,1-dioxothiolane-3-sulfonate |
| SMILES | O=S1(=O)C[C@@H](O)[C@H](S(=O)(=O)[O-])C1 |
| InChI | InChI=1S/C4H8O6S2/c5-3-1-11(6,7)2-4(3)12(8,9)10/h3-5H,1-2H2,(H,8,9,10)/p-1/t3-,4-/m1/s1 |
| InChIKey | ARQIGMQNYUNRHF-QWWZWVQMSA-M |
| XLogP | -2.31 |
| TPSA | 111.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.23 |
| LogP ≤ 5 | -2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|