C5H10O5S2 — CID 2317794
(3R,4R)-4-methylsulfonyl-1,1-dioxothiolan-3-ol (PubChem CID 2317794) has the molecular formula C5H10O5S2 and a molecular weight of 214.26 g/mol. Its IUPAC name is (3R,4R)-4-methylsulfonyl-1,1-dioxothiolan-3-ol.
| Compound Name | (3R,4R)-4-methylsulfonyl-1,1-dioxothiolan-3-ol |
|---|---|
| PubChem CID | 2317794 |
| Molecular Formula | C5H10O5S2 |
| Molecular Weight | 214.26 g/mol |
| Exact Mass | 214.00 |
| IUPAC Name | (3R,4R)-4-methylsulfonyl-1,1-dioxothiolan-3-ol |
| SMILES | CS(=O)(=O)[C@H]1CS(=O)(=O)C[C@H]1O |
| InChI | InChI=1S/C5H10O5S2/c1-11(7,8)5-3-12(9,10)2-4(5)6/h4-6H,2-3H2,1H3/t4-,5+/m1/s1 |
| InChIKey | XLOUZKLQIAFCNQ-UHNVWZDZSA-N |
| XLogP | -1.81 |
| TPSA | 88.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.26 |
| LogP ≤ 5 | -1.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |