C5H10O4S2 — CID 124931899
(3S,4S)-4-[(S)-methylsulfinyl]-1,1-dioxothiolan-3-ol (PubChem CID 124931899) has the molecular formula C5H10O4S2 and a molecular weight of 198.26 g/mol. Its IUPAC name is (3S,4S)-4-[(S)-methylsulfinyl]-1,1-dioxothiolan-3-ol.
| Compound Name | (3S,4S)-4-[(S)-methylsulfinyl]-1,1-dioxothiolan-3-ol |
|---|---|
| PubChem CID | 124931899 |
| Molecular Formula | C5H10O4S2 |
| Molecular Weight | 198.26 g/mol |
| Exact Mass | 198.00 |
| IUPAC Name | (3S,4S)-4-[(S)-methylsulfinyl]-1,1-dioxothiolan-3-ol |
| SMILES | C[S@](=O)[C@@H]1CS(=O)(=O)C[C@@H]1O |
| InChI | InChI=1S/C5H10O4S2/c1-10(7)5-3-11(8,9)2-4(5)6/h4-6H,2-3H2,1H3/t4-,5+,10-/m0/s1 |
| InChIKey | RRHUIWXPMZWPME-LYAQYDMKSA-N |
| XLogP | -1.48 |
| TPSA | 71.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.26 |
| LogP ≤ 5 | -1.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |