C18H17BrClNO3 — CID 7104191
(2S)-4-(4-bromophenyl)-2-[2-(4-chlorophenyl)ethylazaniumyl]-4-oxobutanoate (PubChem CID 7104191) has the molecular formula C18H17BrClNO3 and a molecular weight of 410.70 g/mol. Its IUPAC name is (2S)-4-(4-bromophenyl)-2-[2-(4-chlorophenyl)ethylazaniumyl]-4-oxobutanoate.
| Compound Name | (2S)-4-(4-bromophenyl)-2-[2-(4-chlorophenyl)ethylazaniumyl]-4-oxobutanoate |
|---|---|
| PubChem CID | 7104191 |
| Molecular Formula | C18H17BrClNO3 |
| Molecular Weight | 410.70 g/mol |
| Exact Mass | 409.01 |
| IUPAC Name | (2S)-4-(4-bromophenyl)-2-[2-(4-chlorophenyl)ethylazaniumyl]-4-oxobutanoate |
| SMILES | O=C(C[C@H]([NH2+]CCc1ccc(Cl)cc1)C(=O)[O-])c1ccc(Br)cc1 |
| InChI | InChI=1S/C18H17BrClNO3/c19-14-5-3-13(4-6-14)17(22)11-16(18(23)24)21-10-9-12-1-7-15(20)8-2-12/h1-8,16,21H,9-11H2,(H,23,24)/t16-/m0/s1 |
| InChIKey | CSFCWINMHMGAEX-INIZCTEOSA-N |
| XLogP | 1.60 |
| TPSA | 73.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.70 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |