C25H30Cl2N4O4 — CID 71054222
5-[[3-amino-6-methoxy-7-(5-morpholin-4-ylpentoxy)quinolin-4-yl]amino]-2,4-dichlorophenol (PubChem CID 71054222) has the molecular formula C25H30Cl2N4O4 and a molecular weight of 521.45 g/mol. Its IUPAC name is 5-[[3-amino-6-methoxy-7-(5-morpholin-4-ylpentoxy)quinolin-4-yl]amino]-2,4-dichlorophenol.
| Compound Name | 5-[[3-amino-6-methoxy-7-(5-morpholin-4-ylpentoxy)quinolin-4-yl]amino]-2,4-dichlorophenol |
|---|---|
| PubChem CID | 71054222 |
| Molecular Formula | C25H30Cl2N4O4 |
| Molecular Weight | 521.45 g/mol |
| Exact Mass | 520.16 |
| IUPAC Name | 5-[[3-amino-6-methoxy-7-(5-morpholin-4-ylpentoxy)quinolin-4-yl]amino]-2,4-dichlorophenol |
| SMILES | COc1cc2c(Nc3cc(O)c(Cl)cc3Cl)c(N)cnc2cc1OCCCCCN1CCOCC1 |
| InChI | InChI=1S/C25H30Cl2N4O4/c1-33-23-11-16-20(14-24(23)35-8-4-2-3-5-31-6-9-34-10-7-31)29-15-19(28)25(16)30-21-13-22(32)18(27)12-17(21)26/h11-15,32H,2-10,28H2,1H3,(H,29,30) |
| InChIKey | DSTIHMXQCNDVIQ-UHFFFAOYSA-N |
| XLogP | 5.46 |
| TPSA | 102.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.45 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|