C14H21O3P — CID 71082160
2-[(3S)-3-(4-methylphenyl)cyclopentyl]ethylphosphonic acid (PubChem CID 71082160) has the molecular formula C14H21O3P and a molecular weight of 268.29 g/mol. Its IUPAC name is 2-[(3S)-3-(4-methylphenyl)cyclopentyl]ethylphosphonic acid.
| Compound Name | 2-[(3S)-3-(4-methylphenyl)cyclopentyl]ethylphosphonic acid |
|---|---|
| PubChem CID | 71082160 |
| Molecular Formula | C14H21O3P |
| Molecular Weight | 268.29 g/mol |
| Exact Mass | 268.12 |
| IUPAC Name | 2-[(3S)-3-(4-methylphenyl)cyclopentyl]ethylphosphonic acid |
| SMILES | Cc1ccc([C@H]2CCC(CCP(=O)(O)O)C2)cc1 |
| InChI | InChI=1S/C14H21O3P/c1-11-2-5-13(6-3-11)14-7-4-12(10-14)8-9-18(15,16)17/h2-3,5-6,12,14H,4,7-10H2,1H3,(H2,15,16,17)/t12?,14-/m0/s1 |
| InChIKey | GWMKKXVWDJGOGH-PYMCNQPYSA-N |
| XLogP | 3.45 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.29 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|