C35H35FN2O4 — CID 71103613
(5R)-5-(2-butoxy-4-methoxyphenyl)-4-[1-(4-fluorophenyl)-1-oxopropan-2-yl]-1-(4-phenylphenyl)imidazolidin-2-one (PubChem CID 71103613) has the molecular formula C35H35FN2O4 and a molecular weight of 566.67 g/mol. Its IUPAC name is (5R)-5-(2-butoxy-4-methoxyphenyl)-4-[1-(4-fluorophenyl)-1-oxopropan-2-yl]-1-(4-phenylphenyl)imidazolidin-2-one.
| Compound Name | (5R)-5-(2-butoxy-4-methoxyphenyl)-4-[1-(4-fluorophenyl)-1-oxopropan-2-yl]-1-(4-phenylphenyl)imidazolidin-2-one |
|---|---|
| PubChem CID | 71103613 |
| Molecular Formula | C35H35FN2O4 |
| Molecular Weight | 566.67 g/mol |
| Exact Mass | 566.26 |
| IUPAC Name | (5R)-5-(2-butoxy-4-methoxyphenyl)-4-[1-(4-fluorophenyl)-1-oxopropan-2-yl]-1-(4-phenylphenyl)imidazolidin-2-one |
| SMILES | CCCCOc1cc(OC)ccc1[C@@H]1C(C(C)C(=O)c2ccc(F)cc2)NC(=O)N1c1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C35H35FN2O4/c1-4-5-21-42-31-22-29(41-3)19-20-30(31)33-32(23(2)34(39)26-11-15-27(36)16-12-26)37-35(40)38(33)28-17-13-25(14-18-28)24-9-7-6-8-10-24/h6-20,22-23,32-33H,4-5,21H2,1-3H3,(H,37,40)/t23?,32?,33-/m1/s1 |
| InChIKey | KCCIWNLBTXVMOF-IOMYLLGRSA-N |
| XLogP | 7.84 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.67 |
| LogP ≤ 5 | 7.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|