C19H31NO3 — CID 71107521
N-[(3,4-dimethoxyphenyl)methyl]-3-methyl-N-pentan-2-ylbutanamide (PubChem CID 71107521) has the molecular formula C19H31NO3 and a molecular weight of 321.46 g/mol. Its IUPAC name is N-[(3,4-dimethoxyphenyl)methyl]-3-methyl-N-pentan-2-ylbutanamide.
| Compound Name | N-[(3,4-dimethoxyphenyl)methyl]-3-methyl-N-pentan-2-ylbutanamide |
|---|---|
| PubChem CID | 71107521 |
| Molecular Formula | C19H31NO3 |
| Molecular Weight | 321.46 g/mol |
| Exact Mass | 321.23 |
| IUPAC Name | N-[(3,4-dimethoxyphenyl)methyl]-3-methyl-N-pentan-2-ylbutanamide |
| SMILES | CCCC(C)N(Cc1ccc(OC)c(OC)c1)C(=O)CC(C)C |
| InChI | InChI=1S/C19H31NO3/c1-7-8-15(4)20(19(21)11-14(2)3)13-16-9-10-17(22-5)18(12-16)23-6/h9-10,12,14-15H,7-8,11,13H2,1-6H3 |
| InChIKey | ZCSMQOOMKVUHPK-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.46 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |