C30H24F5NO2S — CID 71115905
2-[2,4-difluoro-N-(2,2,2-trifluoroethyl)anilino]-3-tritylsulfanylpropanoic acid (PubChem CID 71115905) has the molecular formula C30H24F5NO2S and a molecular weight of 557.58 g/mol. Its IUPAC name is 2-[2,4-difluoro-N-(2,2,2-trifluoroethyl)anilino]-3-tritylsulfanylpropanoic acid.
| Compound Name | 2-[2,4-difluoro-N-(2,2,2-trifluoroethyl)anilino]-3-tritylsulfanylpropanoic acid |
|---|---|
| PubChem CID | 71115905 |
| Molecular Formula | C30H24F5NO2S |
| Molecular Weight | 557.58 g/mol |
| Exact Mass | 557.14 |
| IUPAC Name | 2-[2,4-difluoro-N-(2,2,2-trifluoroethyl)anilino]-3-tritylsulfanylpropanoic acid |
| SMILES | O=C(O)C(CSC(c1ccccc1)(c1ccccc1)c1ccccc1)N(CC(F)(F)F)c1ccc(F)cc1F |
| InChI | InChI=1S/C30H24F5NO2S/c31-24-16-17-26(25(32)18-24)36(20-29(33,34)35)27(28(37)38)19-39-30(21-10-4-1-5-11-21,22-12-6-2-7-13-22)23-14-8-3-9-15-23/h1-18,27H,19-20H2,(H,37,38) |
| InChIKey | ZLIBXDNWQYEQHY-UHFFFAOYSA-N |
| XLogP | 7.51 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.58 |
| LogP ≤ 5 | 7.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|