C20H24N2O5 — CID 71117650
9-[[1-(3-carboxypropanoyl)cyclopropyl]amino]-1,2,3,3a,9,9a-hexahydrocyclopenta[b]quinoline-4-carboxylic acid (PubChem CID 71117650) has the molecular formula C20H24N2O5 and a molecular weight of 372.42 g/mol. Its IUPAC name is 9-[[1-(3-carboxypropanoyl)cyclopropyl]amino]-1,2,3,3a,9,9a-hexahydrocyclopenta[b]quinoline-4-carboxylic acid.
| Compound Name | 9-[[1-(3-carboxypropanoyl)cyclopropyl]amino]-1,2,3,3a,9,9a-hexahydrocyclopenta[b]quinoline-4-carboxylic acid |
|---|---|
| PubChem CID | 71117650 |
| Molecular Formula | C20H24N2O5 |
| Molecular Weight | 372.42 g/mol |
| Exact Mass | 372.17 |
| IUPAC Name | 9-[[1-(3-carboxypropanoyl)cyclopropyl]amino]-1,2,3,3a,9,9a-hexahydrocyclopenta[b]quinoline-4-carboxylic acid |
| SMILES | O=C(O)CCC(=O)C1(NC2c3ccccc3N(C(=O)O)C3CCCC23)CC1 |
| InChI | InChI=1S/C20H24N2O5/c23-16(8-9-17(24)25)20(10-11-20)21-18-12-4-1-2-6-14(12)22(19(26)27)15-7-3-5-13(15)18/h1-2,4,6,13,15,18,21H,3,5,7-11H2,(H,24,25)(H,26,27) |
| InChIKey | IEFQKMXAAGLCNC-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 106.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.42 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |