C24H24Cl2N2O4 — CID 71140054
4-[[4-(3,4-dichlorobenzoyl)-1,2,3,3a,9,9a-hexahydrocyclopenta[b]quinolin-9-yl]methylamino]-4-oxobutanoic acid (PubChem CID 71140054) has the molecular formula C24H24Cl2N2O4 and a molecular weight of 475.37 g/mol. Its IUPAC name is 4-[[4-(3,4-dichlorobenzoyl)-1,2,3,3a,9,9a-hexahydrocyclopenta[b]quinolin-9-yl]methylamino]-4-oxobutanoic acid.
| Compound Name | 4-[[4-(3,4-dichlorobenzoyl)-1,2,3,3a,9,9a-hexahydrocyclopenta[b]quinolin-9-yl]methylamino]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 71140054 |
| Molecular Formula | C24H24Cl2N2O4 |
| Molecular Weight | 475.37 g/mol |
| Exact Mass | 474.11 |
| IUPAC Name | 4-[[4-(3,4-dichlorobenzoyl)-1,2,3,3a,9,9a-hexahydrocyclopenta[b]quinolin-9-yl]methylamino]-4-oxobutanoic acid |
| SMILES | O=C(O)CCC(=O)NCC1c2ccccc2N(C(=O)c2ccc(Cl)c(Cl)c2)C2CCCC12 |
| InChI | InChI=1S/C24H24Cl2N2O4/c25-18-9-8-14(12-19(18)26)24(32)28-20-6-2-1-4-15(20)17(16-5-3-7-21(16)28)13-27-22(29)10-11-23(30)31/h1-2,4,6,8-9,12,16-17,21H,3,5,7,10-11,13H2,(H,27,29)(H,30,31) |
| InChIKey | YEFLULKMXCELFM-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.37 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |