About [(2S)-2-(dimethylamino)-3-phenylpropyl] 3-butoxybenzoate
[(2S)-2-(dimethylamino)-3-phenylpropyl] 3-butoxybenzoate (PubChem CID 71130214) has the molecular formula C22H29NO3
and a molecular weight of 355.48 g/mol. Its IUPAC name is [(2S)-2-(dimethylamino)-3-phenylpropyl] 3-butoxybenzoate.
Molecular Properties
| Compound Name | [(2S)-2-(dimethylamino)-3-phenylpropyl] 3-butoxybenzoate |
| PubChem CID | 71130214 |
| Molecular Formula | C22H29NO3 |
| Molecular Weight | 355.48 g/mol |
| Exact Mass | 355.21 |
| IUPAC Name | [(2S)-2-(dimethylamino)-3-phenylpropyl] 3-butoxybenzoate |
| SMILES | CCCCOc1cccc(C(=O)OC[C@H](Cc2ccccc2)N(C)C)c1 |
| InChI | InChI=1S/C22H29NO3/c1-4-5-14-25-21-13-9-12-19(16-21)22(24)26-17-20(23(2)3)15-18-10-7-6-8-11-18/h6-13,16,20H,4-5,14-15,17H2,1-3H3/t20-/m0/s1 |
| InChIKey | HJZLMZVVYOJVKP-FQEVSTJZSA-N |
| XLogP | 4.20 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 355.48 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze [(2S)-2-(dimethylamino)-3-phenylpropyl] 3-butoxybenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(2S)-2-(dimethylamino)-3-phenylpropyl] 3-butoxybenzoate?
The IUPAC name of [(2S)-2-(dimethylamino)-3-phenylpropyl] 3-butoxybenzoate (CID 71130214) is [(2S)-2-(dimethylamino)-3-phenylpropyl] 3-butoxybenzoate.
What is the SMILES notation for [(2S)-2-(dimethylamino)-3-phenylpropyl] 3-butoxybenzoate?
The canonical SMILES for [(2S)-2-(dimethylamino)-3-phenylpropyl] 3-butoxybenzoate is CCCCOc1cccc(C(=O)OC[C@H](Cc2ccccc2)N(C)C)c1.
What is the InChIKey of [(2S)-2-(dimethylamino)-3-phenylpropyl] 3-butoxybenzoate?
The InChIKey is HJZLMZVVYOJVKP-FQEVSTJZSA-N. The full InChI is InChI=1S/C22H29NO3/c1-4-5-14-25-21-13-9-12-19(16-21)22(24)26-17-20(23(2)3)15-18-10-7-6-8-11-18/h6-13,16,20H,4-5,14-15,17H2,1-3H3/t20-/m0/s1.
What are the key properties of [(2S)-2-(dimethylamino)-3-phenylpropyl] 3-butoxybenzoate?
[(2S)-2-(dimethylamino)-3-phenylpropyl] 3-butoxybenzoate has a molecular weight of 355.48 g/mol, XLogP of 4.20, 10 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [(2S)-2-(dimethylamino)-3-phenylpropyl] 3-butoxybenzoate is sourced from PubChem (CID 71130214), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).