C18H13N5 — CID 71139017
N-(1H-indol-5-yl)-3H-pyrazolo[5,4-c]quinolin-4-amine (PubChem CID 71139017) has the molecular formula C18H13N5 and a molecular weight of 299.34 g/mol. Its IUPAC name is N-(1H-indol-5-yl)-3H-pyrazolo[5,4-c]quinolin-4-amine.
| Compound Name | N-(1H-indol-5-yl)-3H-pyrazolo[5,4-c]quinolin-4-amine |
|---|---|
| PubChem CID | 71139017 |
| Molecular Formula | C18H13N5 |
| Molecular Weight | 299.34 g/mol |
| Exact Mass | 299.12 |
| IUPAC Name | N-(1H-indol-5-yl)-3H-pyrazolo[5,4-c]quinolin-4-amine |
| SMILES | c1ccc2c(c1)nc(Nc1ccc3[nH]ccc3c1)c1[nH]ncc12 |
| InChI | InChI=1S/C18H13N5/c1-2-4-16-13(3-1)14-10-20-23-17(14)18(22-16)21-12-5-6-15-11(9-12)7-8-19-15/h1-10,19H,(H,20,23)(H,21,22) |
| InChIKey | QYDAITLPKAKVMA-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 69.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.34 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |