C21H40N2O3Si — CID 71150370
(3E)-1-[(2S,4R)-2-acetyl-4-[tert-butyl(dimethyl)silyl]oxypyrrolidin-1-yl]-3-(2-aminoethylidene)-2-methylhexan-1-one (PubChem CID 71150370) has the molecular formula C21H40N2O3Si and a molecular weight of 396.65 g/mol. Its IUPAC name is (3E)-1-[(2S,4R)-2-acetyl-4-[tert-butyl(dimethyl)silyl]oxypyrrolidin-1-yl]-3-(2-aminoethylidene)-2-methylhexan-1-one.
| Compound Name | (3E)-1-[(2S,4R)-2-acetyl-4-[tert-butyl(dimethyl)silyl]oxypyrrolidin-1-yl]-3-(2-aminoethylidene)-2-methylhexan-1-one |
|---|---|
| PubChem CID | 71150370 |
| Molecular Formula | C21H40N2O3Si |
| Molecular Weight | 396.65 g/mol |
| Exact Mass | 396.28 |
| IUPAC Name | (3E)-1-[(2S,4R)-2-acetyl-4-[tert-butyl(dimethyl)silyl]oxypyrrolidin-1-yl]-3-(2-aminoethylidene)-2-methylhexan-1-one |
| SMILES | CCC/C(=C\CN)C(C)C(=O)N1C[C@H](O[Si](C)(C)C(C)(C)C)C[C@H]1C(C)=O |
| InChI | InChI=1S/C21H40N2O3Si/c1-9-10-17(11-12-22)15(2)20(25)23-14-18(13-19(23)16(3)24)26-27(7,8)21(4,5)6/h11,15,18-19H,9-10,12-14,22H2,1-8H3/b17-11+/t15?,18-,19+/m1/s1 |
| InChIKey | TZYFUQNKYDJYPX-VAYUZYABSA-N |
| XLogP | 3.89 |
| TPSA | 72.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.65 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|