C19H31NO3 — CID 71155688
1-(3,4-dihydroxyphenyl)-4,4-dimethyl-2-(2-methylbutan-2-ylamino)hexan-3-one (PubChem CID 71155688) has the molecular formula C19H31NO3 and a molecular weight of 321.46 g/mol. Its IUPAC name is 1-(3,4-dihydroxyphenyl)-4,4-dimethyl-2-(2-methylbutan-2-ylamino)hexan-3-one.
| Compound Name | 1-(3,4-dihydroxyphenyl)-4,4-dimethyl-2-(2-methylbutan-2-ylamino)hexan-3-one |
|---|---|
| PubChem CID | 71155688 |
| Molecular Formula | C19H31NO3 |
| Molecular Weight | 321.46 g/mol |
| Exact Mass | 321.23 |
| IUPAC Name | 1-(3,4-dihydroxyphenyl)-4,4-dimethyl-2-(2-methylbutan-2-ylamino)hexan-3-one |
| SMILES | CCC(C)(C)NC(Cc1ccc(O)c(O)c1)C(=O)C(C)(C)CC |
| InChI | InChI=1S/C19H31NO3/c1-7-18(3,4)17(23)14(20-19(5,6)8-2)11-13-9-10-15(21)16(22)12-13/h9-10,12,14,20-22H,7-8,11H2,1-6H3 |
| InChIKey | OKQVFUVIHWUMIQ-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.46 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|