C20H20N2O2 — CID 71177769
7-(5-butoxy-1H-indol-2-yl)-2,3-dihydroisoindol-1-one (PubChem CID 71177769) has the molecular formula C20H20N2O2 and a molecular weight of 320.39 g/mol. Its IUPAC name is 7-(5-butoxy-1H-indol-2-yl)-2,3-dihydroisoindol-1-one.
| Compound Name | 7-(5-butoxy-1H-indol-2-yl)-2,3-dihydroisoindol-1-one |
|---|---|
| PubChem CID | 71177769 |
| Molecular Formula | C20H20N2O2 |
| Molecular Weight | 320.39 g/mol |
| Exact Mass | 320.15 |
| IUPAC Name | 7-(5-butoxy-1H-indol-2-yl)-2,3-dihydroisoindol-1-one |
| SMILES | CCCCOc1ccc2[nH]c(-c3cccc4c3C(=O)NC4)cc2c1 |
| InChI | InChI=1S/C20H20N2O2/c1-2-3-9-24-15-7-8-17-14(10-15)11-18(22-17)16-6-4-5-13-12-21-20(23)19(13)16/h4-8,10-11,22H,2-3,9,12H2,1H3,(H,21,23) |
| InChIKey | FGBKZASHXUZXES-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 54.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.39 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|