C14H21NO — CID 71182661
N-tert-butyl-1-(4-methoxy-2,5-dimethylphenyl)methanimine (PubChem CID 71182661) has the molecular formula C14H21NO and a molecular weight of 219.33 g/mol. Its IUPAC name is N-tert-butyl-1-(4-methoxy-2,5-dimethylphenyl)methanimine.
| Compound Name | N-tert-butyl-1-(4-methoxy-2,5-dimethylphenyl)methanimine |
|---|---|
| PubChem CID | 71182661 |
| Molecular Formula | C14H21NO |
| Molecular Weight | 219.33 g/mol |
| Exact Mass | 219.16 |
| IUPAC Name | N-tert-butyl-1-(4-methoxy-2,5-dimethylphenyl)methanimine |
| SMILES | COc1cc(C)c(/C=N/C(C)(C)C)cc1C |
| InChI | InChI=1S/C14H21NO/c1-10-8-13(16-6)11(2)7-12(10)9-15-14(3,4)5/h7-9H,1-6H3/b15-9+ |
| InChIKey | LTHYHQWDTMEHHP-OQLLNIDSSA-N |
| XLogP | 3.53 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.33 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|