C23H27NO6 — CID 71195175
1-(3-butoxypropyl)-3-(6-hydroxy-1,3-benzodioxol-5-yl)-3-(hydroxymethyl)indol-2-one (PubChem CID 71195175) has the molecular formula C23H27NO6 and a molecular weight of 413.47 g/mol. Its IUPAC name is 1-(3-butoxypropyl)-3-(6-hydroxy-1,3-benzodioxol-5-yl)-3-(hydroxymethyl)indol-2-one.
| Compound Name | 1-(3-butoxypropyl)-3-(6-hydroxy-1,3-benzodioxol-5-yl)-3-(hydroxymethyl)indol-2-one |
|---|---|
| PubChem CID | 71195175 |
| Molecular Formula | C23H27NO6 |
| Molecular Weight | 413.47 g/mol |
| Exact Mass | 413.18 |
| IUPAC Name | 1-(3-butoxypropyl)-3-(6-hydroxy-1,3-benzodioxol-5-yl)-3-(hydroxymethyl)indol-2-one |
| SMILES | CCCCOCCCN1C(=O)C(CO)(c2cc3c(cc2O)OCO3)c2ccccc21 |
| InChI | InChI=1S/C23H27NO6/c1-2-3-10-28-11-6-9-24-18-8-5-4-7-16(18)23(14-25,22(24)27)17-12-20-21(13-19(17)26)30-15-29-20/h4-5,7-8,12-13,25-26H,2-3,6,9-11,14-15H2,1H3 |
| InChIKey | GECREOKHNGAOQK-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 88.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.47 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|