C26H37O3P — CID 71195654
2,10-ditert-butyl-6-hexoxybenzo[d][1,3,2]benzodioxaphosphepine (PubChem CID 71195654) has the molecular formula C26H37O3P and a molecular weight of 428.55 g/mol. Its IUPAC name is 2,10-ditert-butyl-6-hexoxybenzo[d][1,3,2]benzodioxaphosphepine.
| Compound Name | 2,10-ditert-butyl-6-hexoxybenzo[d][1,3,2]benzodioxaphosphepine |
|---|---|
| PubChem CID | 71195654 |
| Molecular Formula | C26H37O3P |
| Molecular Weight | 428.55 g/mol |
| Exact Mass | 428.25 |
| IUPAC Name | 2,10-ditert-butyl-6-hexoxybenzo[d][1,3,2]benzodioxaphosphepine |
| SMILES | CCCCCCOp1oc2ccc(C(C)(C)C)cc2c2cc(C(C)(C)C)ccc2o1 |
| InChI | InChI=1S/C26H37O3P/c1-8-9-10-11-16-27-30-28-23-14-12-19(25(2,3)4)17-21(23)22-18-20(26(5,6)7)13-15-24(22)29-30/h12-15,17-18H,8-11,16H2,1-7H3 |
| InChIKey | ICEVVEFIAFIGRT-UHFFFAOYSA-N |
| XLogP | 8.89 |
| TPSA | 35.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.55 |
| LogP ≤ 5 | 8.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|