C19H22N4O2S — CID 71198854
6-[1-(cyclopropanecarbonyl)-3,4,4a,5,7,7a-hexahydro-2H-pyrrolo[3,4-b]pyridin-6-yl]-1,2-benzothiazole-3-carboxamide (PubChem CID 71198854) has the molecular formula C19H22N4O2S and a molecular weight of 370.48 g/mol. Its IUPAC name is 6-[1-(cyclopropanecarbonyl)-3,4,4a,5,7,7a-hexahydro-2H-pyrrolo[3,4-b]pyridin-6-yl]-1,2-benzothiazole-3-carboxamide.
| Compound Name | 6-[1-(cyclopropanecarbonyl)-3,4,4a,5,7,7a-hexahydro-2H-pyrrolo[3,4-b]pyridin-6-yl]-1,2-benzothiazole-3-carboxamide |
|---|---|
| PubChem CID | 71198854 |
| Molecular Formula | C19H22N4O2S |
| Molecular Weight | 370.48 g/mol |
| Exact Mass | 370.15 |
| IUPAC Name | 6-[1-(cyclopropanecarbonyl)-3,4,4a,5,7,7a-hexahydro-2H-pyrrolo[3,4-b]pyridin-6-yl]-1,2-benzothiazole-3-carboxamide |
| SMILES | NC(=O)c1nsc2cc(N3CC4CCCN(C(=O)C5CC5)C4C3)ccc12 |
| InChI | InChI=1S/C19H22N4O2S/c20-18(24)17-14-6-5-13(8-16(14)26-21-17)22-9-12-2-1-7-23(15(12)10-22)19(25)11-3-4-11/h5-6,8,11-12,15H,1-4,7,9-10H2,(H2,20,24) |
| InChIKey | XDVHHGPERIJQJE-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 79.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.48 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |