C9H9N5O2 — CID 71203766
5-ethyl-1,7-dihydroimidazo[1,2-a]purine-6,9-dione (PubChem CID 71203766) has the molecular formula C9H9N5O2 and a molecular weight of 219.20 g/mol. Its IUPAC name is 5-ethyl-1,7-dihydroimidazo[1,2-a]purine-6,9-dione.
| Compound Name | 5-ethyl-1,7-dihydroimidazo[1,2-a]purine-6,9-dione |
|---|---|
| PubChem CID | 71203766 |
| Molecular Formula | C9H9N5O2 |
| Molecular Weight | 219.20 g/mol |
| Exact Mass | 219.08 |
| IUPAC Name | 5-ethyl-1,7-dihydroimidazo[1,2-a]purine-6,9-dione |
| SMILES | CCN1C(=O)Cn2c1nc1nc[nH]c1c2=O |
| InChI | InChI=1S/C9H9N5O2/c1-2-13-5(15)3-14-8(16)6-7(11-4-10-6)12-9(13)14/h4H,2-3H2,1H3,(H,10,11) |
| InChIKey | DROYJSCUHGBIGE-UHFFFAOYSA-N |
| XLogP | -0.51 |
| TPSA | 83.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.20 |
| LogP ≤ 5 | -0.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |