C25H31FN4O2 — CID 71221045
5-[2-fluoro-5-[(3-methoxypropylamino)methyl]phenyl]-3-piperidin-4-yl-1H-indole-7-carboxamide (PubChem CID 71221045) has the molecular formula C25H31FN4O2 and a molecular weight of 438.55 g/mol. Its IUPAC name is 5-[2-fluoro-5-[(3-methoxypropylamino)methyl]phenyl]-3-piperidin-4-yl-1H-indole-7-carboxamide.
| Compound Name | 5-[2-fluoro-5-[(3-methoxypropylamino)methyl]phenyl]-3-piperidin-4-yl-1H-indole-7-carboxamide |
|---|---|
| PubChem CID | 71221045 |
| Molecular Formula | C25H31FN4O2 |
| Molecular Weight | 438.55 g/mol |
| Exact Mass | 438.24 |
| IUPAC Name | 5-[2-fluoro-5-[(3-methoxypropylamino)methyl]phenyl]-3-piperidin-4-yl-1H-indole-7-carboxamide |
| SMILES | COCCCNCc1ccc(F)c(-c2cc(C(N)=O)c3[nH]cc(C4CCNCC4)c3c2)c1 |
| InChI | InChI=1S/C25H31FN4O2/c1-32-10-2-7-29-14-16-3-4-23(26)19(11-16)18-12-20-22(17-5-8-28-9-6-17)15-30-24(20)21(13-18)25(27)31/h3-4,11-13,15,17,28-30H,2,5-10,14H2,1H3,(H2,27,31) |
| InChIKey | SVHLZEGEUVPGDJ-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 92.17 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.55 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|