About 2-chloro-6,7-dihydro-5H-pyrrolo[3,4-d]pyrimidine;hydrochloride
2-chloro-6,7-dihydro-5H-pyrrolo[3,4-d]pyrimidine;hydrochloride (PubChem CID 71302509) has the molecular formula C6H7Cl2N3
and a molecular weight of 192.05 g/mol. Its IUPAC name is 2-chloro-6,7-dihydro-5H-pyrrolo[3,4-d]pyrimidine;hydrochloride.
Molecular Properties
| Compound Name | 2-chloro-6,7-dihydro-5H-pyrrolo[3,4-d]pyrimidine;hydrochloride |
| PubChem CID | 71302509 |
| Molecular Formula | C6H7Cl2N3 |
| Molecular Weight | 192.05 g/mol |
| Exact Mass | 191.00 |
| IUPAC Name | 2-chloro-6,7-dihydro-5H-pyrrolo[3,4-d]pyrimidine;hydrochloride |
| SMILES | Cl.Clc1ncc2c(n1)CNC2 |
| InChI | InChI=1S/C6H6ClN3.ClH/c7-6-9-2-4-1-8-3-5(4)10-6;/h2,8H,1,3H2;1H |
| InChIKey | BPTXRFXCELOADD-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 192.05 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-chloro-6,7-dihydro-5H-pyrrolo[3,4-d]pyrimidine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chloro-6,7-dihydro-5H-pyrrolo[3,4-d]pyrimidine;hydrochloride?
The IUPAC name of 2-chloro-6,7-dihydro-5H-pyrrolo[3,4-d]pyrimidine;hydrochloride (CID 71302509) is 2-chloro-6,7-dihydro-5H-pyrrolo[3,4-d]pyrimidine;hydrochloride.
What is the SMILES notation for 2-chloro-6,7-dihydro-5H-pyrrolo[3,4-d]pyrimidine;hydrochloride?
The canonical SMILES for 2-chloro-6,7-dihydro-5H-pyrrolo[3,4-d]pyrimidine;hydrochloride is Cl.Clc1ncc2c(n1)CNC2.
What is the InChIKey of 2-chloro-6,7-dihydro-5H-pyrrolo[3,4-d]pyrimidine;hydrochloride?
The InChIKey is BPTXRFXCELOADD-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H6ClN3.ClH/c7-6-9-2-4-1-8-3-5(4)10-6;/h2,8H,1,3H2;1H.
What are the key properties of 2-chloro-6,7-dihydro-5H-pyrrolo[3,4-d]pyrimidine;hydrochloride?
2-chloro-6,7-dihydro-5H-pyrrolo[3,4-d]pyrimidine;hydrochloride has a molecular weight of 192.05 g/mol, XLogP of 1.15, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chloro-6,7-dihydro-5H-pyrrolo[3,4-d]pyrimidine;hydrochloride is sourced from PubChem (CID 71302509), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).