C12H16N4O2 — CID 71303793
5-nitro-3-pyridin-2-yl-2,3,3a,4,5,6,7,7a-octahydro-1H-indazole (PubChem CID 71303793) has the molecular formula C12H16N4O2 and a molecular weight of 248.29 g/mol. Its IUPAC name is 5-nitro-3-pyridin-2-yl-2,3,3a,4,5,6,7,7a-octahydro-1H-indazole.
| Compound Name | 5-nitro-3-pyridin-2-yl-2,3,3a,4,5,6,7,7a-octahydro-1H-indazole |
|---|---|
| PubChem CID | 71303793 |
| Molecular Formula | C12H16N4O2 |
| Molecular Weight | 248.29 g/mol |
| Exact Mass | 248.13 |
| IUPAC Name | 5-nitro-3-pyridin-2-yl-2,3,3a,4,5,6,7,7a-octahydro-1H-indazole |
| SMILES | O=[N+]([O-])C1CCC2NNC(c3ccccn3)C2C1 |
| InChI | InChI=1S/C12H16N4O2/c17-16(18)8-4-5-10-9(7-8)12(15-14-10)11-3-1-2-6-13-11/h1-3,6,8-10,12,14-15H,4-5,7H2 |
| InChIKey | HKGXXWUTWVWYTI-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 80.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.29 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|