C10H14O2 — CID 71313445
1,1,1,3,3,3-hexadeuterio-2-(4-methoxyphenyl)propan-2-ol (PubChem CID 71313445) has the molecular formula C10H14O2 and a molecular weight of 172.26 g/mol. Its IUPAC name is 1,1,1,3,3,3-hexadeuterio-2-(4-methoxyphenyl)propan-2-ol.
| Compound Name | 1,1,1,3,3,3-hexadeuterio-2-(4-methoxyphenyl)propan-2-ol |
|---|---|
| PubChem CID | 71313445 |
| Molecular Formula | C10H14O2 |
| Molecular Weight | 172.26 g/mol |
| Exact Mass | 172.14 |
| IUPAC Name | 1,1,1,3,3,3-hexadeuterio-2-(4-methoxyphenyl)propan-2-ol |
| SMILES | [2H]C([2H])([2H])C(O)(c1ccc(OC)cc1)C([2H])([2H])[2H] |
| InChI | InChI=1S/C10H14O2/c1-10(2,11)8-4-6-9(12-3)7-5-8/h4-7,11H,1-3H3/i1D3,2D3 |
| InChIKey | BFXOWZOXTDBCHP-WFGJKAKNSA-N |
| XLogP | 1.92 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 172.26 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |