C19H39NO2 — CID 71315135
butane;(E,7R,8R)-6-(dimethylamino)-7-hydroxy-8-methyldodec-10-en-5-one (PubChem CID 71315135) has the molecular formula C19H39NO2 and a molecular weight of 313.53 g/mol. Its IUPAC name is butane;(E,7R,8R)-6-(dimethylamino)-7-hydroxy-8-methyldodec-10-en-5-one.
| Compound Name | butane;(E,7R,8R)-6-(dimethylamino)-7-hydroxy-8-methyldodec-10-en-5-one |
|---|---|
| PubChem CID | 71315135 |
| Molecular Formula | C19H39NO2 |
| Molecular Weight | 313.53 g/mol |
| Exact Mass | 313.30 |
| IUPAC Name | butane;(E,7R,8R)-6-(dimethylamino)-7-hydroxy-8-methyldodec-10-en-5-one |
| SMILES | C/C=C/C[C@@H](C)[C@@H](O)C(C(=O)CCCC)N(C)C.CCCC |
| InChI | InChI=1S/C15H29NO2.C4H10/c1-6-8-10-12(3)15(18)14(16(4)5)13(17)11-9-7-2;1-3-4-2/h6,8,12,14-15,18H,7,9-11H2,1-5H3;3-4H2,1-2H3/b8-6+;/t12-,14?,15-;/m1./s1 |
| InChIKey | YWOHTTLEIZTTAR-QLERBJDDSA-N |
| XLogP | 4.45 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.53 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|