C22H26F3N3O2S — CID 71316896
2-[2,2,3,3,5,5,6,6-octadeuterio-4-[3-[5-oxo-2-(trifluoromethyl)phenothiazin-10-yl]propyl]piperazin-1-yl]ethanol (PubChem CID 71316896) has the molecular formula C22H26F3N3O2S and a molecular weight of 461.58 g/mol. Its IUPAC name is 2-[2,2,3,3,5,5,6,6-octadeuterio-4-[3-[5-oxo-2-(trifluoromethyl)phenothiazin-10-yl]propyl]piperazin-1-yl]ethanol.
| Compound Name | 2-[2,2,3,3,5,5,6,6-octadeuterio-4-[3-[5-oxo-2-(trifluoromethyl)phenothiazin-10-yl]propyl]piperazin-1-yl]ethanol |
|---|---|
| PubChem CID | 71316896 |
| Molecular Formula | C22H26F3N3O2S |
| Molecular Weight | 461.58 g/mol |
| Exact Mass | 461.22 |
| IUPAC Name | 2-[2,2,3,3,5,5,6,6-octadeuterio-4-[3-[5-oxo-2-(trifluoromethyl)phenothiazin-10-yl]propyl]piperazin-1-yl]ethanol |
| SMILES | [2H]C1([2H])N(CCO)C([2H])([2H])C([2H])([2H])N(CCCN2c3ccccc3S(=O)c3ccc(C(F)(F)F)cc32)C1([2H])[2H] |
| InChI | InChI=1S/C22H26F3N3O2S/c23-22(24,25)17-6-7-21-19(16-17)28(18-4-1-2-5-20(18)31(21)30)9-3-8-26-10-12-27(13-11-26)14-15-29/h1-2,4-7,16,29H,3,8-15H2/i10D2,11D2,12D2,13D2 |
| InChIKey | UFPPOFUTIWYLNR-BGKXKQMNSA-N |
| XLogP | 3.32 |
| TPSA | 47.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.58 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |