C23H20N4O — CID 71335046
4-[2-[4,5-bis(4-aminophenyl)-1,3-oxazol-2-yl]ethenyl]aniline (PubChem CID 71335046) has the molecular formula C23H20N4O and a molecular weight of 368.44 g/mol. Its IUPAC name is 4-[2-[4,5-bis(4-aminophenyl)-1,3-oxazol-2-yl]ethenyl]aniline.
| Compound Name | 4-[2-[4,5-bis(4-aminophenyl)-1,3-oxazol-2-yl]ethenyl]aniline |
|---|---|
| PubChem CID | 71335046 |
| Molecular Formula | C23H20N4O |
| Molecular Weight | 368.44 g/mol |
| Exact Mass | 368.16 |
| IUPAC Name | 4-[2-[4,5-bis(4-aminophenyl)-1,3-oxazol-2-yl]ethenyl]aniline |
| SMILES | Nc1ccc(C=Cc2nc(-c3ccc(N)cc3)c(-c3ccc(N)cc3)o2)cc1 |
| InChI | InChI=1S/C23H20N4O/c24-18-8-1-15(2-9-18)3-14-21-27-22(16-4-10-19(25)11-5-16)23(28-21)17-6-12-20(26)13-7-17/h1-14H,24-26H2 |
| InChIKey | CBTWOYNBBZHGLW-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 104.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.44 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|