About Quinoline, 8-(dimethylsilyl)-
Quinoline, 8-(dimethylsilyl)- (PubChem CID 71342862) has the molecular formula C11H12NSi
and a molecular weight of 186.31 g/mol.
Molecular Properties
| Compound Name | Quinoline, 8-(dimethylsilyl)- |
| PubChem CID | 71342862 |
| Molecular Formula | C11H12NSi |
| Molecular Weight | 186.31 g/mol |
| Exact Mass | 186.07 |
| IUPAC Name | — |
| SMILES | C[Si](C)c1cccc2cccnc12 |
| InChI | InChI=1S/C11H12NSi/c1-13(2)10-7-3-5-9-6-4-8-12-11(9)10/h3-8H,1-2H3 |
| InChIKey | QGXAIFGUJHYKQX-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 186.31 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze Quinoline, 8-(dimethylsilyl)- with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of Quinoline, 8-(dimethylsilyl)-?
The IUPAC name of Quinoline, 8-(dimethylsilyl)- (CID 71342862) is not available.
What is the SMILES notation for Quinoline, 8-(dimethylsilyl)-?
The canonical SMILES for Quinoline, 8-(dimethylsilyl)- is C[Si](C)c1cccc2cccnc12.
What is the InChIKey of Quinoline, 8-(dimethylsilyl)-?
The InChIKey is QGXAIFGUJHYKQX-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H12NSi/c1-13(2)10-7-3-5-9-6-4-8-12-11(9)10/h3-8H,1-2H3.
What are the key properties of Quinoline, 8-(dimethylsilyl)-?
Quinoline, 8-(dimethylsilyl)- has a molecular weight of 186.31 g/mol, XLogP of 2.20, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for Quinoline, 8-(dimethylsilyl)- is sourced from PubChem (CID 71342862), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).