C7H14N2O3S — CID 71365629
2-(1-aminoprop-2-enylideneamino)-2-methylpropane-1-sulfonic acid (PubChem CID 71365629) has the molecular formula C7H14N2O3S and a molecular weight of 206.27 g/mol. Its IUPAC name is 2-(1-aminoprop-2-enylideneamino)-2-methylpropane-1-sulfonic acid.
| Compound Name | 2-(1-aminoprop-2-enylideneamino)-2-methylpropane-1-sulfonic acid |
|---|---|
| PubChem CID | 71365629 |
| Molecular Formula | C7H14N2O3S |
| Molecular Weight | 206.27 g/mol |
| Exact Mass | 206.07 |
| IUPAC Name | 2-(1-aminoprop-2-enylideneamino)-2-methylpropane-1-sulfonic acid |
| SMILES | C=C/C(N)=N\C(C)(C)CS(=O)(=O)O |
| InChI | InChI=1S/C7H14N2O3S/c1-4-6(8)9-7(2,3)5-13(10,11)12/h4H,1,5H2,2-3H3,(H2,8,9)(H,10,11,12) |
| InChIKey | VEKSLPUKXMERMM-UHFFFAOYSA-N |
| XLogP | 0.20 |
| TPSA | 92.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.27 |
| LogP ≤ 5 | 0.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|