C12H24N4 — CID 71383717
3,5-bis(3-methylbutyl)-1,2,4-triazol-4-amine (PubChem CID 71383717) has the molecular formula C12H24N4 and a molecular weight of 224.35 g/mol. Its IUPAC name is 3,5-bis(3-methylbutyl)-1,2,4-triazol-4-amine.
| Compound Name | 3,5-bis(3-methylbutyl)-1,2,4-triazol-4-amine |
|---|---|
| PubChem CID | 71383717 |
| Molecular Formula | C12H24N4 |
| Molecular Weight | 224.35 g/mol |
| Exact Mass | 224.20 |
| IUPAC Name | 3,5-bis(3-methylbutyl)-1,2,4-triazol-4-amine |
| SMILES | CC(C)CCc1nnc(CCC(C)C)n1N |
| InChI | InChI=1S/C12H24N4/c1-9(2)5-7-11-14-15-12(16(11)13)8-6-10(3)4/h9-10H,5-8,13H2,1-4H3 |
| InChIKey | OIWXAJRJGJGXTH-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.35 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |