C13H18Cl2O6S — CID 71399805
acetic acid;3-chloro-2-(4-chlorophenyl)sulfanylpropane-1,1-diol (PubChem CID 71399805) has the molecular formula C13H18Cl2O6S and a molecular weight of 373.25 g/mol. Its IUPAC name is acetic acid;3-chloro-2-(4-chlorophenyl)sulfanylpropane-1,1-diol.
| Compound Name | acetic acid;3-chloro-2-(4-chlorophenyl)sulfanylpropane-1,1-diol |
|---|---|
| PubChem CID | 71399805 |
| Molecular Formula | C13H18Cl2O6S |
| Molecular Weight | 373.25 g/mol |
| Exact Mass | 372.02 |
| IUPAC Name | acetic acid;3-chloro-2-(4-chlorophenyl)sulfanylpropane-1,1-diol |
| SMILES | CC(=O)O.CC(=O)O.OC(O)C(CCl)Sc1ccc(Cl)cc1 |
| InChI | InChI=1S/C9H10Cl2O2S.2C2H4O2/c10-5-8(9(12)13)14-7-3-1-6(11)2-4-7;2*1-2(3)4/h1-4,8-9,12-13H,5H2;2*1H3,(H,3,4) |
| InChIKey | SHVMSXZDRWGSIH-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 115.06 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.25 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|