C18H24N2OS — CID 71406063
2-[(4-ethenylphenyl)methylsulfanyl]-5-heptyl-1,3,4-oxadiazole (PubChem CID 71406063) has the molecular formula C18H24N2OS and a molecular weight of 316.47 g/mol. Its IUPAC name is 2-[(4-ethenylphenyl)methylsulfanyl]-5-heptyl-1,3,4-oxadiazole.
| Compound Name | 2-[(4-ethenylphenyl)methylsulfanyl]-5-heptyl-1,3,4-oxadiazole |
|---|---|
| PubChem CID | 71406063 |
| Molecular Formula | C18H24N2OS |
| Molecular Weight | 316.47 g/mol |
| Exact Mass | 316.16 |
| IUPAC Name | 2-[(4-ethenylphenyl)methylsulfanyl]-5-heptyl-1,3,4-oxadiazole |
| SMILES | C=Cc1ccc(CSc2nnc(CCCCCCC)o2)cc1 |
| InChI | InChI=1S/C18H24N2OS/c1-3-5-6-7-8-9-17-19-20-18(21-17)22-14-16-12-10-15(4-2)11-13-16/h4,10-13H,2-3,5-9,14H2,1H3 |
| InChIKey | FFVZLJABWPFECH-UHFFFAOYSA-N |
| XLogP | 5.52 |
| TPSA | 38.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.47 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|