C11H14N4O8S — CID 71415067
2-(4-acetamido-2,6-dinitroanilino)ethyl methanesulfonate (PubChem CID 71415067) has the molecular formula C11H14N4O8S and a molecular weight of 362.32 g/mol. Its IUPAC name is 2-(4-acetamido-2,6-dinitroanilino)ethyl methanesulfonate.
| Compound Name | 2-(4-acetamido-2,6-dinitroanilino)ethyl methanesulfonate |
|---|---|
| PubChem CID | 71415067 |
| Molecular Formula | C11H14N4O8S |
| Molecular Weight | 362.32 g/mol |
| Exact Mass | 362.05 |
| IUPAC Name | 2-(4-acetamido-2,6-dinitroanilino)ethyl methanesulfonate |
| SMILES | CC(=O)Nc1cc([N+](=O)[O-])c(NCCOS(C)(=O)=O)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C11H14N4O8S/c1-7(16)13-8-5-9(14(17)18)11(10(6-8)15(19)20)12-3-4-23-24(2,21)22/h5-6,12H,3-4H2,1-2H3,(H,13,16) |
| InChIKey | GPONUPPISLPPRZ-UHFFFAOYSA-N |
| XLogP | 0.85 |
| TPSA | 170.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.32 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|