C18H27BrN4O9S — CID 143976081
2-[3-(2-bromoethyl)-2-[ethyl(4-hydroxybutyl)carbamoyl]-4,6-dinitroanilino]ethyl methanesulfonate (PubChem CID 143976081) has the molecular formula C18H27BrN4O9S and a molecular weight of 555.40 g/mol. Its IUPAC name is 2-[3-(2-bromoethyl)-2-[ethyl(4-hydroxybutyl)carbamoyl]-4,6-dinitroanilino]ethyl methanesulfonate.
| Compound Name | 2-[3-(2-bromoethyl)-2-[ethyl(4-hydroxybutyl)carbamoyl]-4,6-dinitroanilino]ethyl methanesulfonate |
|---|---|
| PubChem CID | 143976081 |
| Molecular Formula | C18H27BrN4O9S |
| Molecular Weight | 555.40 g/mol |
| Exact Mass | 554.07 |
| IUPAC Name | 2-[3-(2-bromoethyl)-2-[ethyl(4-hydroxybutyl)carbamoyl]-4,6-dinitroanilino]ethyl methanesulfonate |
| SMILES | CCN(CCCCO)C(=O)c1c(CCBr)c([N+](=O)[O-])cc([N+](=O)[O-])c1NCCOS(C)(=O)=O |
| InChI | InChI=1S/C18H27BrN4O9S/c1-3-21(9-4-5-10-24)18(25)16-13(6-7-19)14(22(26)27)12-15(23(28)29)17(16)20-8-11-32-33(2,30)31/h12,20,24H,3-11H2,1-2H3 |
| InChIKey | CZODPWWXVLOLFW-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 182.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.40 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|