C9H10AsN2O3 — CID 71438252
CID 71438252 (PubChem CID 71438252) has the molecular formula C9H10AsN2O3 and a molecular weight of 269.11 g/mol.
| Compound Name | CID 71438252 |
|---|---|
| PubChem CID | 71438252 |
| Molecular Formula | C9H10AsN2O3 |
| Molecular Weight | 269.11 g/mol |
| Exact Mass | 268.99 |
| IUPAC Name | — |
| SMILES | NC(=O)CNC(=O)c1ccc([AsH]=O)cc1 |
| InChI | InChI=1S/C9H10AsN2O3/c11-8(13)5-12-9(14)6-1-3-7(10-15)4-2-6/h1-4,10H,5H2,(H2,11,13)(H,12,14) |
| InChIKey | JVMLYNIBKQXEKT-UHFFFAOYSA-N |
| XLogP | -1.69 |
| TPSA | 89.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.11 |
| LogP ≤ 5 | -1.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|