C17H17FN2 — CID 71440732
3-(3-fluorophenyl)-1,2-dimethyl-5-phenyl-3H-pyrazole (PubChem CID 71440732) has the molecular formula C17H17FN2 and a molecular weight of 268.34 g/mol. Its IUPAC name is 3-(3-fluorophenyl)-1,2-dimethyl-5-phenyl-3H-pyrazole.
| Compound Name | 3-(3-fluorophenyl)-1,2-dimethyl-5-phenyl-3H-pyrazole |
|---|---|
| PubChem CID | 71440732 |
| Molecular Formula | C17H17FN2 |
| Molecular Weight | 268.34 g/mol |
| Exact Mass | 268.14 |
| IUPAC Name | 3-(3-fluorophenyl)-1,2-dimethyl-5-phenyl-3H-pyrazole |
| SMILES | CN1C(c2ccccc2)=CC(c2cccc(F)c2)N1C |
| InChI | InChI=1S/C17H17FN2/c1-19-16(13-7-4-3-5-8-13)12-17(20(19)2)14-9-6-10-15(18)11-14/h3-12,17H,1-2H3 |
| InChIKey | SVUABACCFMMCDJ-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.34 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |