C23H20FN2+ — CID 102583025
2-(3-fluorophenyl)-1,3-dimethyl-4,5-diphenylimidazol-1-ium (PubChem CID 102583025) has the molecular formula C23H20FN2+ and a molecular weight of 343.43 g/mol. Its IUPAC name is 2-(3-fluorophenyl)-1,3-dimethyl-4,5-diphenylimidazol-1-ium.
| Compound Name | 2-(3-fluorophenyl)-1,3-dimethyl-4,5-diphenylimidazol-1-ium |
|---|---|
| PubChem CID | 102583025 |
| Molecular Formula | C23H20FN2+ |
| Molecular Weight | 343.43 g/mol |
| Exact Mass | 343.16 |
| IUPAC Name | 2-(3-fluorophenyl)-1,3-dimethyl-4,5-diphenylimidazol-1-ium |
| SMILES | Cn1c(-c2ccccc2)c(-c2ccccc2)[n+](C)c1-c1cccc(F)c1 |
| InChI | InChI=1S/C23H20FN2/c1-25-21(17-10-5-3-6-11-17)22(18-12-7-4-8-13-18)26(2)23(25)19-14-9-15-20(24)16-19/h3-16H,1-2H3/q+1 |
| InChIKey | DROBZVKDXPRUSQ-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 8.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.43 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|