C34H14BF15N2 — CID 177431270
(3-methyl-4,5-diphenylimidazol-1-ium-1-yl)-tris(2,3,4,5,6-pentafluorophenyl)boranuide (PubChem CID 177431270) has the molecular formula C34H14BF15N2 and a molecular weight of 746.28 g/mol. Its IUPAC name is (3-methyl-4,5-diphenylimidazol-1-ium-1-yl)-tris(2,3,4,5,6-pentafluorophenyl)boranuide.
| Compound Name | (3-methyl-4,5-diphenylimidazol-1-ium-1-yl)-tris(2,3,4,5,6-pentafluorophenyl)boranuide |
|---|---|
| PubChem CID | 177431270 |
| Molecular Formula | C34H14BF15N2 |
| Molecular Weight | 746.28 g/mol |
| Exact Mass | 746.10 |
| IUPAC Name | (3-methyl-4,5-diphenylimidazol-1-ium-1-yl)-tris(2,3,4,5,6-pentafluorophenyl)boranuide |
| SMILES | Cn1c[n+]([B-](c2c(F)c(F)c(F)c(F)c2F)(c2c(F)c(F)c(F)c(F)c2F)c2c(F)c(F)c(F)c(F)c2F)c(-c2ccccc2)c1-c1ccccc1 |
| InChI | InChI=1S/C34H14BF15N2/c1-51-12-52(34(14-10-6-3-7-11-14)33(51)13-8-4-2-5-9-13)35(15-18(36)24(42)30(48)25(43)19(15)37,16-20(38)26(44)31(49)27(45)21(16)39)17-22(40)28(46)32(50)29(47)23(17)41/h2-12H,1H3 |
| InChIKey | UTYKECQHGXTQBH-UHFFFAOYSA-N |
| XLogP | 7.25 |
| TPSA | 8.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 746.28 |
| LogP ≤ 5 | 7.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|