C13H18O3 — CID 71453277
2-[(3S)-1-[(2R)-oxiran-2-yl]pentan-3-yl]benzene-1,4-diol (PubChem CID 71453277) has the molecular formula C13H18O3 and a molecular weight of 222.28 g/mol. Its IUPAC name is 2-[(3S)-1-[(2R)-oxiran-2-yl]pentan-3-yl]benzene-1,4-diol.
| Compound Name | 2-[(3S)-1-[(2R)-oxiran-2-yl]pentan-3-yl]benzene-1,4-diol |
|---|---|
| PubChem CID | 71453277 |
| Molecular Formula | C13H18O3 |
| Molecular Weight | 222.28 g/mol |
| Exact Mass | 222.13 |
| IUPAC Name | 2-[(3S)-1-[(2R)-oxiran-2-yl]pentan-3-yl]benzene-1,4-diol |
| SMILES | CC[C@@H](CC[C@@H]1CO1)c1cc(O)ccc1O |
| InChI | InChI=1S/C13H18O3/c1-2-9(3-5-11-8-16-11)12-7-10(14)4-6-13(12)15/h4,6-7,9,11,14-15H,2-3,5,8H2,1H3/t9-,11+/m0/s1 |
| InChIKey | HUHPNANFXCZDTD-GXSJLCMTSA-N |
| XLogP | 2.77 |
| TPSA | 52.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.28 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|