About 2-hexan-3-yl-4-[4-(4-hydroxyphenyl)cyclohexa-1,3-dien-1-yl]phenol
2-hexan-3-yl-4-[4-(4-hydroxyphenyl)cyclohexa-1,3-dien-1-yl]phenol (PubChem CID 67512455) has the molecular formula C24H28O2
and a molecular weight of 348.49 g/mol. Its IUPAC name is 2-hexan-3-yl-4-[4-(4-hydroxyphenyl)cyclohexa-1,3-dien-1-yl]phenol.
Molecular Properties
| Compound Name | 2-hexan-3-yl-4-[4-(4-hydroxyphenyl)cyclohexa-1,3-dien-1-yl]phenol |
| PubChem CID | 67512455 |
| Molecular Formula | C24H28O2 |
| Molecular Weight | 348.49 g/mol |
| Exact Mass | 348.21 |
| IUPAC Name | 2-hexan-3-yl-4-[4-(4-hydroxyphenyl)cyclohexa-1,3-dien-1-yl]phenol |
| SMILES | CCCC(CC)c1cc(C2=CC=C(c3ccc(O)cc3)CC2)ccc1O |
| InChI | InChI=1S/C24H28O2/c1-3-5-17(4-2)23-16-21(12-15-24(23)26)20-8-6-18(7-9-20)19-10-13-22(25)14-11-19/h6,8,10-17,25-26H,3-5,7,9H2,1-2H3 |
| InChIKey | ZHJZUAAQWVBCFX-UHFFFAOYSA-N |
| XLogP | 6.65 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 348.49 |
| LogP ≤ 5 | 6.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-hexan-3-yl-4-[4-(4-hydroxyphenyl)cyclohexa-1,3-dien-1-yl]phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-hexan-3-yl-4-[4-(4-hydroxyphenyl)cyclohexa-1,3-dien-1-yl]phenol?
The IUPAC name of 2-hexan-3-yl-4-[4-(4-hydroxyphenyl)cyclohexa-1,3-dien-1-yl]phenol (CID 67512455) is 2-hexan-3-yl-4-[4-(4-hydroxyphenyl)cyclohexa-1,3-dien-1-yl]phenol.
What is the SMILES notation for 2-hexan-3-yl-4-[4-(4-hydroxyphenyl)cyclohexa-1,3-dien-1-yl]phenol?
The canonical SMILES for 2-hexan-3-yl-4-[4-(4-hydroxyphenyl)cyclohexa-1,3-dien-1-yl]phenol is CCCC(CC)c1cc(C2=CC=C(c3ccc(O)cc3)CC2)ccc1O.
What is the InChIKey of 2-hexan-3-yl-4-[4-(4-hydroxyphenyl)cyclohexa-1,3-dien-1-yl]phenol?
The InChIKey is ZHJZUAAQWVBCFX-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H28O2/c1-3-5-17(4-2)23-16-21(12-15-24(23)26)20-8-6-18(7-9-20)19-10-13-22(25)14-11-19/h6,8,10-17,25-26H,3-5,7,9H2,1-2H3.
What are the key properties of 2-hexan-3-yl-4-[4-(4-hydroxyphenyl)cyclohexa-1,3-dien-1-yl]phenol?
2-hexan-3-yl-4-[4-(4-hydroxyphenyl)cyclohexa-1,3-dien-1-yl]phenol has a molecular weight of 348.49 g/mol, XLogP of 6.65, 6 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-hexan-3-yl-4-[4-(4-hydroxyphenyl)cyclohexa-1,3-dien-1-yl]phenol is sourced from PubChem (CID 67512455), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).