C17H18ClN5O4S2 — CID 71469015
5-[(4aS)-3-amino-2-methyl-1,1-dioxo-7,7a-dihydro-5H-furo[3,4-e][1,2,4]thiadiazin-4a-yl]-4-chloro-N-(6-methyl-2-pyridinyl)thiophene-2-carboxamide (PubChem CID 71469015) has the molecular formula C17H18ClN5O4S2 and a molecular weight of 455.95 g/mol. Its IUPAC name is 5-[(4aS)-3-amino-2-methyl-1,1-dioxo-7,7a-dihydro-5H-furo[3,4-e][1,2,4]thiadiazin-4a-yl]-4-chloro-N-(6-methyl-2-pyridinyl)thiophene-2-carboxamide.
| Compound Name | 5-[(4aS)-3-amino-2-methyl-1,1-dioxo-7,7a-dihydro-5H-furo[3,4-e][1,2,4]thiadiazin-4a-yl]-4-chloro-N-(6-methyl-2-pyridinyl)thiophene-2-carboxamide |
|---|---|
| PubChem CID | 71469015 |
| Molecular Formula | C17H18ClN5O4S2 |
| Molecular Weight | 455.95 g/mol |
| Exact Mass | 455.05 |
| IUPAC Name | 5-[(4aS)-3-amino-2-methyl-1,1-dioxo-7,7a-dihydro-5H-furo[3,4-e][1,2,4]thiadiazin-4a-yl]-4-chloro-N-(6-methyl-2-pyridinyl)thiophene-2-carboxamide |
| SMILES | Cc1cccc(NC(=O)c2cc(Cl)c([C@]34COCC3S(=O)(=O)N(C)C(N)=N4)s2)n1 |
| InChI | InChI=1S/C17H18ClN5O4S2/c1-9-4-3-5-13(20-9)21-15(24)11-6-10(18)14(28-11)17-8-27-7-12(17)29(25,26)23(2)16(19)22-17/h3-6,12H,7-8H2,1-2H3,(H2,19,22)(H,20,21,24)/t12?,17-/m0/s1 |
| InChIKey | OMWBANJLCATHOW-TYJDENFWSA-N |
| XLogP | 1.54 |
| TPSA | 126.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.95 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |