C18H20ClN5O4S2 — CID 89036703
5-[(4aS)-3-amino-2-methyl-1,1-dioxo-5,6,8,8a-tetrahydropyrano[4,3-e][1,2,4]thiadiazin-4a-yl]-4-chloro-N-(6-methyl-2-pyridinyl)thiophene-2-carboxamide (PubChem CID 89036703) has the molecular formula C18H20ClN5O4S2 and a molecular weight of 469.98 g/mol. Its IUPAC name is 5-[(4aS)-3-amino-2-methyl-1,1-dioxo-5,6,8,8a-tetrahydropyrano[4,3-e][1,2,4]thiadiazin-4a-yl]-4-chloro-N-(6-methyl-2-pyridinyl)thiophene-2-carboxamide.
| Compound Name | 5-[(4aS)-3-amino-2-methyl-1,1-dioxo-5,6,8,8a-tetrahydropyrano[4,3-e][1,2,4]thiadiazin-4a-yl]-4-chloro-N-(6-methyl-2-pyridinyl)thiophene-2-carboxamide |
|---|---|
| PubChem CID | 89036703 |
| Molecular Formula | C18H20ClN5O4S2 |
| Molecular Weight | 469.98 g/mol |
| Exact Mass | 469.06 |
| IUPAC Name | 5-[(4aS)-3-amino-2-methyl-1,1-dioxo-5,6,8,8a-tetrahydropyrano[4,3-e][1,2,4]thiadiazin-4a-yl]-4-chloro-N-(6-methyl-2-pyridinyl)thiophene-2-carboxamide |
| SMILES | Cc1cccc(NC(=O)c2cc(Cl)c([C@]34CCOCC3S(=O)(=O)N(C)C(N)=N4)s2)n1 |
| InChI | InChI=1S/C18H20ClN5O4S2/c1-10-4-3-5-14(21-10)22-16(25)12-8-11(19)15(29-12)18-6-7-28-9-13(18)30(26,27)24(2)17(20)23-18/h3-5,8,13H,6-7,9H2,1-2H3,(H2,20,23)(H,21,22,25)/t13?,18-/m0/s1 |
| InChIKey | UBMYBGUTMYTTLL-UWBLVGDVSA-N |
| XLogP | 1.93 |
| TPSA | 126.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.98 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |