C14H19Cl2NO2 — CID 71474070
(1S)-1-[(3R,4R)-3-(3,4-dichlorophenyl)azepan-4-yl]ethane-1,2-diol (PubChem CID 71474070) has the molecular formula C14H19Cl2NO2 and a molecular weight of 304.22 g/mol. Its IUPAC name is (1S)-1-[(3R,4R)-3-(3,4-dichlorophenyl)azepan-4-yl]ethane-1,2-diol.
| Compound Name | (1S)-1-[(3R,4R)-3-(3,4-dichlorophenyl)azepan-4-yl]ethane-1,2-diol |
|---|---|
| PubChem CID | 71474070 |
| Molecular Formula | C14H19Cl2NO2 |
| Molecular Weight | 304.22 g/mol |
| Exact Mass | 303.08 |
| IUPAC Name | (1S)-1-[(3R,4R)-3-(3,4-dichlorophenyl)azepan-4-yl]ethane-1,2-diol |
| SMILES | OC[C@@H](O)[C@@H]1CCCNC[C@H]1c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C14H19Cl2NO2/c15-12-4-3-9(6-13(12)16)11-7-17-5-1-2-10(11)14(19)8-18/h3-4,6,10-11,14,17-19H,1-2,5,7-8H2/t10-,11+,14-/m1/s1 |
| InChIKey | HYFKBUGYGPUDOR-UHIISALHSA-N |
| XLogP | 2.43 |
| TPSA | 52.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.22 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |