C21H15F7O8 — CID 71492896
dimethyl 6-(1,1,2,2,3,3,3-heptafluoropropyl)-6,9-dihydroxy-3-methoxybenzo[c]chromene-8,10-dicarboxylate (PubChem CID 71492896) has the molecular formula C21H15F7O8 and a molecular weight of 528.33 g/mol. Its IUPAC name is dimethyl 6-(1,1,2,2,3,3,3-heptafluoropropyl)-6,9-dihydroxy-3-methoxybenzo[c]chromene-8,10-dicarboxylate.
| Compound Name | dimethyl 6-(1,1,2,2,3,3,3-heptafluoropropyl)-6,9-dihydroxy-3-methoxybenzo[c]chromene-8,10-dicarboxylate |
|---|---|
| PubChem CID | 71492896 |
| Molecular Formula | C21H15F7O8 |
| Molecular Weight | 528.33 g/mol |
| Exact Mass | 528.07 |
| IUPAC Name | dimethyl 6-(1,1,2,2,3,3,3-heptafluoropropyl)-6,9-dihydroxy-3-methoxybenzo[c]chromene-8,10-dicarboxylate |
| SMILES | COC(=O)c1cc2c(c(C(=O)OC)c1O)-c1ccc(OC)cc1OC2(O)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C21H15F7O8/c1-33-8-4-5-9-12(6-8)36-18(32,19(22,23)20(24,25)21(26,27)28)11-7-10(16(30)34-2)15(29)14(13(9)11)17(31)35-3/h4-7,29,32H,1-3H3 |
| InChIKey | BOYFTMPAZVPRPI-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 111.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.33 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|