C24H15F7O7 — CID 71493068
dimethyl 6-(1,1,2,2,3,3,3-heptafluoropropyl)-6,9-dihydroxynaphtho[1,2-c]isochromene-8,10-dicarboxylate (PubChem CID 71493068) has the molecular formula C24H15F7O7 and a molecular weight of 548.36 g/mol. Its IUPAC name is dimethyl 6-(1,1,2,2,3,3,3-heptafluoropropyl)-6,9-dihydroxynaphtho[1,2-c]isochromene-8,10-dicarboxylate.
| Compound Name | dimethyl 6-(1,1,2,2,3,3,3-heptafluoropropyl)-6,9-dihydroxynaphtho[1,2-c]isochromene-8,10-dicarboxylate |
|---|---|
| PubChem CID | 71493068 |
| Molecular Formula | C24H15F7O7 |
| Molecular Weight | 548.36 g/mol |
| Exact Mass | 548.07 |
| IUPAC Name | dimethyl 6-(1,1,2,2,3,3,3-heptafluoropropyl)-6,9-dihydroxynaphtho[1,2-c]isochromene-8,10-dicarboxylate |
| SMILES | COC(=O)c1cc2c(c(C(=O)OC)c1O)-c1ccc3ccccc3c1OC2(O)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C24H15F7O7/c1-36-19(33)13-9-14-15(16(17(13)32)20(34)37-2)12-8-7-10-5-3-4-6-11(10)18(12)38-21(14,35)22(25,26)23(27,28)24(29,30)31/h3-9,32,35H,1-2H3 |
| InChIKey | HYBMWYOJNJODDM-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 102.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.36 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|