C10H8F7NO2 — CID 71502097
ethyl 5-(1,1,2,2,3,3,3-heptafluoropropyl)-1H-pyrrole-2-carboxylate (PubChem CID 71502097) has the molecular formula C10H8F7NO2 and a molecular weight of 307.17 g/mol. Its IUPAC name is ethyl 5-(1,1,2,2,3,3,3-heptafluoropropyl)-1H-pyrrole-2-carboxylate.
| Compound Name | ethyl 5-(1,1,2,2,3,3,3-heptafluoropropyl)-1H-pyrrole-2-carboxylate |
|---|---|
| PubChem CID | 71502097 |
| Molecular Formula | C10H8F7NO2 |
| Molecular Weight | 307.17 g/mol |
| Exact Mass | 307.04 |
| IUPAC Name | ethyl 5-(1,1,2,2,3,3,3-heptafluoropropyl)-1H-pyrrole-2-carboxylate |
| SMILES | CCOC(=O)c1ccc(C(F)(F)C(F)(F)C(F)(F)F)[nH]1 |
| InChI | InChI=1S/C10H8F7NO2/c1-2-20-7(19)5-3-4-6(18-5)8(11,12)9(13,14)10(15,16)17/h3-4,18H,2H2,1H3 |
| InChIKey | PQXDWZFFXZFVIS-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 42.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.17 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|