C41H55N3O8SSi — CID 71505015
methyl (E)-3-[1-(benzenesulfonyl)-4-[bis[(2-methylpropan-2-yl)oxycarbonyl]amino]indol-3-yl]-2-[1-tri(propan-2-yl)silylpyrrol-3-yl]prop-2-enoate (PubChem CID 71505015) has the molecular formula C41H55N3O8SSi and a molecular weight of 778.06 g/mol. Its IUPAC name is methyl (E)-3-[1-(benzenesulfonyl)-4-[bis[(2-methylpropan-2-yl)oxycarbonyl]amino]indol-3-yl]-2-[1-tri(propan-2-yl)silylpyrrol-3-yl]prop-2-enoate.
| Compound Name | methyl (E)-3-[1-(benzenesulfonyl)-4-[bis[(2-methylpropan-2-yl)oxycarbonyl]amino]indol-3-yl]-2-[1-tri(propan-2-yl)silylpyrrol-3-yl]prop-2-enoate |
|---|---|
| PubChem CID | 71505015 |
| Molecular Formula | C41H55N3O8SSi |
| Molecular Weight | 778.06 g/mol |
| Exact Mass | 777.35 |
| IUPAC Name | methyl (E)-3-[1-(benzenesulfonyl)-4-[bis[(2-methylpropan-2-yl)oxycarbonyl]amino]indol-3-yl]-2-[1-tri(propan-2-yl)silylpyrrol-3-yl]prop-2-enoate |
| SMILES | COC(=O)/C(=C/c1cn(S(=O)(=O)c2ccccc2)c2cccc(N(C(=O)OC(C)(C)C)C(=O)OC(C)(C)C)c12)c1ccn([Si](C(C)C)(C(C)C)C(C)C)c1 |
| InChI | InChI=1S/C41H55N3O8SSi/c1-27(2)54(28(3)4,29(5)6)42-23-22-30(25-42)33(37(45)50-13)24-31-26-43(53(48,49)32-18-15-14-16-19-32)34-20-17-21-35(36(31)34)44(38(46)51-40(7,8)9)39(47)52-41(10,11)12/h14-29H,1-13H3/b33-24+ |
| InChIKey | SJHYSTQGSUGBTI-IWBSIUBASA-N |
| XLogP | 10.09 |
| TPSA | 126.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 778.06 |
| LogP ≤ 5 | 10.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|